C23H26BrN3O4S — CID 155524669
N-[2-[2-(3-bromophenyl)-4-oxo-1,3-thiazolidin-3-yl]phenyl]-N'-hydroxyoctanediamide (PubChem CID 155524669) has the molecular formula C23H26BrN3O4S and a molecular weight of 520.45 g/mol. Its IUPAC name is N-[2-[2-(3-bromophenyl)-4-oxo-1,3-thiazolidin-3-yl]phenyl]-N'-hydroxyoctanediamide.
| Compound Name | N-[2-[2-(3-bromophenyl)-4-oxo-1,3-thiazolidin-3-yl]phenyl]-N'-hydroxyoctanediamide |
|---|---|
| PubChem CID | 155524669 |
| Molecular Formula | C23H26BrN3O4S |
| Molecular Weight | 520.45 g/mol |
| Exact Mass | 519.08 |
| IUPAC Name | N-[2-[2-(3-bromophenyl)-4-oxo-1,3-thiazolidin-3-yl]phenyl]-N'-hydroxyoctanediamide |
| SMILES | O=C(CCCCCCC(=O)Nc1ccccc1N1C(=O)CSC1c1cccc(Br)c1)NO |
| InChI | InChI=1S/C23H26BrN3O4S/c24-17-9-7-8-16(14-17)23-27(22(30)15-32-23)19-11-6-5-10-18(19)25-20(28)12-3-1-2-4-13-21(29)26-31/h5-11,14,23,31H,1-4,12-13,15H2,(H,25,28)(H,26,29) |
| InChIKey | KBCQSTIHBGIXEM-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|