C27H36N2O2S — CID 42807663
N-[3-[3-(3,5-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]decanamide (PubChem CID 42807663) has the molecular formula C27H36N2O2S and a molecular weight of 452.66 g/mol. Its IUPAC name is N-[3-[3-(3,5-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]decanamide.
| Compound Name | N-[3-[3-(3,5-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]decanamide |
|---|---|
| PubChem CID | 42807663 |
| Molecular Formula | C27H36N2O2S |
| Molecular Weight | 452.66 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | N-[3-[3-(3,5-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl]decanamide |
| SMILES | CCCCCCCCCC(=O)Nc1cccc(C2SCC(=O)N2c2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C27H36N2O2S/c1-4-5-6-7-8-9-10-14-25(30)28-23-13-11-12-22(18-23)27-29(26(31)19-32-27)24-16-20(2)15-21(3)17-24/h11-13,15-18,27H,4-10,14,19H2,1-3H3,(H,28,30) |
| InChIKey | IKIMZQCNQZRQCD-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.66 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|