C21H19ClN4O3 — CID 155526516
1-(4-chlorophenyl)-3-[[6-(4-methoxyphenyl)-2-methylpyridine-3-carbonyl]amino]urea (PubChem CID 155526516) has the molecular formula C21H19ClN4O3 and a molecular weight of 410.86 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[[6-(4-methoxyphenyl)-2-methylpyridine-3-carbonyl]amino]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[[6-(4-methoxyphenyl)-2-methylpyridine-3-carbonyl]amino]urea |
|---|---|
| PubChem CID | 155526516 |
| Molecular Formula | C21H19ClN4O3 |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[[6-(4-methoxyphenyl)-2-methylpyridine-3-carbonyl]amino]urea |
| SMILES | COc1ccc(-c2ccc(C(=O)NNC(=O)Nc3ccc(Cl)cc3)c(C)n2)cc1 |
| InChI | InChI=1S/C21H19ClN4O3/c1-13-18(11-12-19(23-13)14-3-9-17(29-2)10-4-14)20(27)25-26-21(28)24-16-7-5-15(22)6-8-16/h3-12H,1-2H3,(H,25,27)(H2,24,26,28) |
| InChIKey | CTYLOKRQEKTOOD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|