C22H25F3N2O2 — CID 155526745
3-[2-(dipropylamino)ethoxy]-6-(trifluoromethyl)-10H-acridin-9-one (PubChem CID 155526745) has the molecular formula C22H25F3N2O2 and a molecular weight of 406.45 g/mol. Its IUPAC name is 3-[2-(dipropylamino)ethoxy]-6-(trifluoromethyl)-10H-acridin-9-one.
| Compound Name | 3-[2-(dipropylamino)ethoxy]-6-(trifluoromethyl)-10H-acridin-9-one |
|---|---|
| PubChem CID | 155526745 |
| Molecular Formula | C22H25F3N2O2 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 3-[2-(dipropylamino)ethoxy]-6-(trifluoromethyl)-10H-acridin-9-one |
| SMILES | CCCN(CCC)CCOc1ccc2c(=O)c3ccc(C(F)(F)F)cc3[nH]c2c1 |
| InChI | InChI=1S/C22H25F3N2O2/c1-3-9-27(10-4-2)11-12-29-16-6-8-18-20(14-16)26-19-13-15(22(23,24)25)5-7-17(19)21(18)28/h5-8,13-14H,3-4,9-12H2,1-2H3,(H,26,28) |
| InChIKey | FDVDUPWIVUYSSR-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|