C19H27N3O4S2 — CID 155526761
[3-[2-[[2-(4-isothiocyanatobutylsulfinyl)acetyl]amino]ethyl]phenyl] N-ethyl-N-methylcarbamate (PubChem CID 155526761) has the molecular formula C19H27N3O4S2 and a molecular weight of 425.58 g/mol. Its IUPAC name is [3-[2-[[2-(4-isothiocyanatobutylsulfinyl)acetyl]amino]ethyl]phenyl] N-ethyl-N-methylcarbamate.
| Compound Name | [3-[2-[[2-(4-isothiocyanatobutylsulfinyl)acetyl]amino]ethyl]phenyl] N-ethyl-N-methylcarbamate |
|---|---|
| PubChem CID | 155526761 |
| Molecular Formula | C19H27N3O4S2 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | [3-[2-[[2-(4-isothiocyanatobutylsulfinyl)acetyl]amino]ethyl]phenyl] N-ethyl-N-methylcarbamate |
| SMILES | CCN(C)C(=O)Oc1cccc(CCNC(=O)CS(=O)CCCCN=C=S)c1 |
| InChI | InChI=1S/C19H27N3O4S2/c1-3-22(2)19(24)26-17-8-6-7-16(13-17)9-11-21-18(23)14-28(25)12-5-4-10-20-15-27/h6-8,13H,3-5,9-12,14H2,1-2H3,(H,21,23) |
| InChIKey | KUJASBBRKMTCKG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|