C17H11ClFN3O3S — CID 155527183
4-chloro-2-fluoro-N-(2-methyl-3-oxo-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaen-9-yl)benzenesulfonamide (PubChem CID 155527183) has the molecular formula C17H11ClFN3O3S and a molecular weight of 391.81 g/mol. Its IUPAC name is 4-chloro-2-fluoro-N-(2-methyl-3-oxo-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaen-9-yl)benzenesulfonamide.
| Compound Name | 4-chloro-2-fluoro-N-(2-methyl-3-oxo-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaen-9-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 155527183 |
| Molecular Formula | C17H11ClFN3O3S |
| Molecular Weight | 391.81 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | 4-chloro-2-fluoro-N-(2-methyl-3-oxo-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaen-9-yl)benzenesulfonamide |
| SMILES | CN1C(=O)c2ccnc3c(NS(=O)(=O)c4ccc(Cl)cc4F)ccc1c23 |
| InChI | InChI=1S/C17H11ClFN3O3S/c1-22-13-4-3-12(16-15(13)10(17(22)23)6-7-20-16)21-26(24,25)14-5-2-9(18)8-11(14)19/h2-8,21H,1H3 |
| InChIKey | JQJRSYBOGLUBBM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.81 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |