C22H22ClN5O3S — CID 155558707
4-chloro-N-[2-methyl-6-(4-methylpiperazin-1-yl)-3-oxo-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaen-9-yl]benzenesulfonamide (PubChem CID 155558707) has the molecular formula C22H22ClN5O3S and a molecular weight of 471.97 g/mol. Its IUPAC name is 4-chloro-N-[2-methyl-6-(4-methylpiperazin-1-yl)-3-oxo-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaen-9-yl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[2-methyl-6-(4-methylpiperazin-1-yl)-3-oxo-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaen-9-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 155558707 |
| Molecular Formula | C22H22ClN5O3S |
| Molecular Weight | 471.97 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 4-chloro-N-[2-methyl-6-(4-methylpiperazin-1-yl)-3-oxo-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaen-9-yl]benzenesulfonamide |
| SMILES | CN1CCN(c2cc3c4c(ccc(NS(=O)(=O)c5ccc(Cl)cc5)c4n2)N(C)C3=O)CC1 |
| InChI | InChI=1S/C22H22ClN5O3S/c1-26-9-11-28(12-10-26)19-13-16-20-18(27(2)22(16)29)8-7-17(21(20)24-19)25-32(30,31)15-5-3-14(23)4-6-15/h3-8,13,25H,9-12H2,1-2H3 |
| InChIKey | GUBFNRREBZFIDH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.97 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |