C23H21FN6OS — CID 155528867
4-(4-fluorophenyl)-5-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]-1,3-thiazol-2-amine (PubChem CID 155528867) has the molecular formula C23H21FN6OS and a molecular weight of 448.53 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-5-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]-1,3-thiazol-2-amine.
| Compound Name | 4-(4-fluorophenyl)-5-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 155528867 |
| Molecular Formula | C23H21FN6OS |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 4-(4-fluorophenyl)-5-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2ccc(F)cc2)c(-c2ccnc(Nc3ccc(N4CCOCC4)cc3)n2)s1 |
| InChI | InChI=1S/C23H21FN6OS/c24-16-3-1-15(2-4-16)20-21(32-22(25)29-20)19-9-10-26-23(28-19)27-17-5-7-18(8-6-17)30-11-13-31-14-12-30/h1-10H,11-14H2,(H2,25,29)(H,26,27,28) |
| InChIKey | OAIYZWZQCIKJJL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|