C22H23BrN2O5 — CID 155528992
[4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethylphenyl] 2-bromo-2-methylpropanoate (PubChem CID 155528992) has the molecular formula C22H23BrN2O5 and a molecular weight of 475.34 g/mol. Its IUPAC name is [4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethylphenyl] 2-bromo-2-methylpropanoate.
| Compound Name | [4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethylphenyl] 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 155528992 |
| Molecular Formula | C22H23BrN2O5 |
| Molecular Weight | 475.34 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | [4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethylphenyl] 2-bromo-2-methylpropanoate |
| SMILES | COc1cc(OC)c2c(=O)[nH]c(-c3cc(C)c(OC(=O)C(C)(C)Br)c(C)c3)nc2c1 |
| InChI | InChI=1S/C22H23BrN2O5/c1-11-7-13(8-12(2)18(11)30-21(27)22(3,4)23)19-24-15-9-14(28-5)10-16(29-6)17(15)20(26)25-19/h7-10H,1-6H3,(H,24,25,26) |
| InChIKey | NEJWWIWBSDLGOU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 90.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|