C22H23BrN2O7 — CID 155517447
[4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethoxyphenyl] 2-bromo-2-methylpropanoate (PubChem CID 155517447) has the molecular formula C22H23BrN2O7 and a molecular weight of 507.34 g/mol. Its IUPAC name is [4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethoxyphenyl] 2-bromo-2-methylpropanoate.
| Compound Name | [4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethoxyphenyl] 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 155517447 |
| Molecular Formula | C22H23BrN2O7 |
| Molecular Weight | 507.34 g/mol |
| Exact Mass | 506.07 |
| IUPAC Name | [4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethoxyphenyl] 2-bromo-2-methylpropanoate |
| SMILES | COc1cc(OC)c2c(=O)[nH]c(-c3cc(OC)c(OC(=O)C(C)(C)Br)c(OC)c3)nc2c1 |
| InChI | InChI=1S/C22H23BrN2O7/c1-22(2,23)21(27)32-18-15(30-5)7-11(8-16(18)31-6)19-24-13-9-12(28-3)10-14(29-4)17(13)20(26)25-19/h7-10H,1-6H3,(H,24,25,26) |
| InChIKey | SLBWBCMXQLMGQA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 108.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|