C23H12Cl2F3NO3 — CID 155529423
4-[3-(2,6-dichlorobenzoyl)indol-1-yl]-2-(trifluoromethyl)benzoic acid (PubChem CID 155529423) has the molecular formula C23H12Cl2F3NO3 and a molecular weight of 478.25 g/mol. Its IUPAC name is 4-[3-(2,6-dichlorobenzoyl)indol-1-yl]-2-(trifluoromethyl)benzoic acid.
| Compound Name | 4-[3-(2,6-dichlorobenzoyl)indol-1-yl]-2-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 155529423 |
| Molecular Formula | C23H12Cl2F3NO3 |
| Molecular Weight | 478.25 g/mol |
| Exact Mass | 477.01 |
| IUPAC Name | 4-[3-(2,6-dichlorobenzoyl)indol-1-yl]-2-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(-n2cc(C(=O)c3c(Cl)cccc3Cl)c3ccccc32)cc1C(F)(F)F |
| InChI | InChI=1S/C23H12Cl2F3NO3/c24-17-5-3-6-18(25)20(17)21(30)15-11-29(19-7-2-1-4-13(15)19)12-8-9-14(22(31)32)16(10-12)23(26,27)28/h1-11H,(H,31,32) |
| InChIKey | UDLBMLJUZHTNIK-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.25 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |