C28H30F6N4O10S3 — CID 155529426
2-[[2-[[2-[4-[[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]amino]-1,1-dioxothian-4-yl]-1,3-benzothiazol-6-yl]oxy]acetyl]amino]ethanesulfonic acid;2,2,2-trifluoroacetic acid (PubChem CID 155529426) has the molecular formula C28H30F6N4O10S3 and a molecular weight of 792.75 g/mol. Its IUPAC name is 2-[[2-[[2-[4-[[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]amino]-1,1-dioxothian-4-yl]-1,3-benzothiazol-6-yl]oxy]acetyl]amino]ethanesulfonic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[2-[[2-[4-[[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]amino]-1,1-dioxothian-4-yl]-1,3-benzothiazol-6-yl]oxy]acetyl]amino]ethanesulfonic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155529426 |
| Molecular Formula | C28H30F6N4O10S3 |
| Molecular Weight | 792.75 g/mol |
| Exact Mass | 792.10 |
| IUPAC Name | 2-[[2-[[2-[4-[[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]amino]-1,1-dioxothian-4-yl]-1,3-benzothiazol-6-yl]oxy]acetyl]amino]ethanesulfonic acid;2,2,2-trifluoroacetic acid |
| SMILES | N[C@@H](CC(=O)NC1(c2nc3ccc(OCC(=O)NCCS(=O)(=O)O)cc3s2)CCS(=O)(=O)CC1)Cc1cc(F)c(F)cc1F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H29F3N4O8S3.C2HF3O2/c27-18-13-20(29)19(28)10-15(18)9-16(30)11-23(34)33-26(3-6-43(36,37)7-4-26)25-32-21-2-1-17(12-22(21)42-25)41-14-24(35)31-5-8-44(38,39)40;3-2(4,5)1(6)7/h1-2,10,12-13,16H,3-9,11,14,30H2,(H,31,35)(H,33,34)(H,38,39,40);(H,6,7)/t16-;/m1./s1 |
| InChIKey | JXIGIFSXLAAYEF-PKLMIRHRSA-N |
| XLogP | 2.21 |
| TPSA | 232.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.75 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|