C20H14BrF6N3O2S — CID 155529919
4-[3,5-bis(trifluoromethyl)phenyl]-N-[(E)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-1,3-thiazol-2-amine (PubChem CID 155529919) has the molecular formula C20H14BrF6N3O2S and a molecular weight of 554.31 g/mol. Its IUPAC name is 4-[3,5-bis(trifluoromethyl)phenyl]-N-[(E)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-[3,5-bis(trifluoromethyl)phenyl]-N-[(E)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 155529919 |
| Molecular Formula | C20H14BrF6N3O2S |
| Molecular Weight | 554.31 g/mol |
| Exact Mass | 552.99 |
| IUPAC Name | 4-[3,5-bis(trifluoromethyl)phenyl]-N-[(E)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-1,3-thiazol-2-amine |
| SMILES | COc1cc(/C=N/Nc2nc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)cs2)cc(Br)c1OC |
| InChI | InChI=1S/C20H14BrF6N3O2S/c1-31-16-4-10(3-14(21)17(16)32-2)8-28-30-18-29-15(9-33-18)11-5-12(19(22,23)24)7-13(6-11)20(25,26)27/h3-9H,1-2H3,(H,29,30)/b28-8+ |
| InChIKey | DMZXPXLRWHQDDI-YLKCYHHESA-N |
| XLogP | 7.07 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.31 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|