C20H13Br2F6N3O2S — CID 155550511
4-[3,5-bis(trifluoromethyl)phenyl]-N-[(E)-(2,3-dibromo-4,5-dimethoxyphenyl)methylideneamino]-1,3-thiazol-2-amine (PubChem CID 155550511) has the molecular formula C20H13Br2F6N3O2S and a molecular weight of 633.21 g/mol. Its IUPAC name is 4-[3,5-bis(trifluoromethyl)phenyl]-N-[(E)-(2,3-dibromo-4,5-dimethoxyphenyl)methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-[3,5-bis(trifluoromethyl)phenyl]-N-[(E)-(2,3-dibromo-4,5-dimethoxyphenyl)methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 155550511 |
| Molecular Formula | C20H13Br2F6N3O2S |
| Molecular Weight | 633.21 g/mol |
| Exact Mass | 630.90 |
| IUPAC Name | 4-[3,5-bis(trifluoromethyl)phenyl]-N-[(E)-(2,3-dibromo-4,5-dimethoxyphenyl)methylideneamino]-1,3-thiazol-2-amine |
| SMILES | COc1cc(/C=N/Nc2nc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)cs2)c(Br)c(Br)c1OC |
| InChI | InChI=1S/C20H13Br2F6N3O2S/c1-32-14-5-10(15(21)16(22)17(14)33-2)7-29-31-18-30-13(8-34-18)9-3-11(19(23,24)25)6-12(4-9)20(26,27)28/h3-8H,1-2H3,(H,30,31)/b29-7+ |
| InChIKey | ATYHCVIUMHWDBP-HBRQFSJYSA-N |
| XLogP | 7.84 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.21 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|