C21H18ClNO4 — CID 155530092
3-[[4-(4-chlorophenyl)phenyl]methoxy]-N-hydroxy-4-methoxybenzamide (PubChem CID 155530092) has the molecular formula C21H18ClNO4 and a molecular weight of 383.83 g/mol. Its IUPAC name is 3-[[4-(4-chlorophenyl)phenyl]methoxy]-N-hydroxy-4-methoxybenzamide.
| Compound Name | 3-[[4-(4-chlorophenyl)phenyl]methoxy]-N-hydroxy-4-methoxybenzamide |
|---|---|
| PubChem CID | 155530092 |
| Molecular Formula | C21H18ClNO4 |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 3-[[4-(4-chlorophenyl)phenyl]methoxy]-N-hydroxy-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NO)cc1OCc1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H18ClNO4/c1-26-19-11-8-17(21(24)23-25)12-20(19)27-13-14-2-4-15(5-3-14)16-6-9-18(22)10-7-16/h2-12,25H,13H2,1H3,(H,23,24) |
| InChIKey | LRDNFUOROHPOLN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|