C21H19ClN2O3 — CID 78774841
4-[(4-chlorophenyl)methoxy]-3-methoxy-N'-phenylbenzohydrazide (PubChem CID 78774841) has the molecular formula C21H19ClN2O3 and a molecular weight of 382.85 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methoxy]-3-methoxy-N'-phenylbenzohydrazide.
| Compound Name | 4-[(4-chlorophenyl)methoxy]-3-methoxy-N'-phenylbenzohydrazide |
|---|---|
| PubChem CID | 78774841 |
| Molecular Formula | C21H19ClN2O3 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 4-[(4-chlorophenyl)methoxy]-3-methoxy-N'-phenylbenzohydrazide |
| SMILES | COc1cc(C(=O)NNc2ccccc2)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H19ClN2O3/c1-26-20-13-16(21(25)24-23-18-5-3-2-4-6-18)9-12-19(20)27-14-15-7-10-17(22)11-8-15/h2-13,23H,14H2,1H3,(H,24,25) |
| InChIKey | DKPZDZLMAIXVSL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|