C33H42O5 — CID 155530565
(6Z)-5-hydroxy-4-[(1R,2R,5S)-2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexyl]-6-[hydroxy(phenyl)methylidene]-2,2-bis(3-methylbut-2-enyl)cyclohex-4-ene-1,3-dione (PubChem CID 155530565) has the molecular formula C33H42O5 and a molecular weight of 518.69 g/mol. Its IUPAC name is (6Z)-5-hydroxy-4-[(1R,2R,5S)-2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexyl]-6-[hydroxy(phenyl)methylidene]-2,2-bis(3-methylbut-2-enyl)cyclohex-4-ene-1,3-dione.
| Compound Name | (6Z)-5-hydroxy-4-[(1R,2R,5S)-2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexyl]-6-[hydroxy(phenyl)methylidene]-2,2-bis(3-methylbut-2-enyl)cyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 155530565 |
| Molecular Formula | C33H42O5 |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | (6Z)-5-hydroxy-4-[(1R,2R,5S)-2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexyl]-6-[hydroxy(phenyl)methylidene]-2,2-bis(3-methylbut-2-enyl)cyclohex-4-ene-1,3-dione |
| SMILES | C=C(C)[C@H]1CC[C@@](C)(O)[C@@H](C2=C(O)/C(=C(/O)c3ccccc3)C(=O)C(CC=C(C)C)(CC=C(C)C)C2=O)C1 |
| InChI | InChI=1S/C33H42O5/c1-20(2)13-17-33(18-14-21(3)4)30(36)26(25-19-24(22(5)6)15-16-32(25,7)38)29(35)27(31(33)37)28(34)23-11-9-8-10-12-23/h8-14,24-25,34-35,38H,5,15-19H2,1-4,6-7H3/b28-27-/t24-,25+,32+/m0/s1 |
| InChIKey | PDTKDGJZQOMOAJ-PSHTVKHDSA-N |
| XLogP | 7.36 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|