C17H14N2O — CID 155530957
5-methyl-2-[(1E,3E)-4-pyridin-4-ylbuta-1,3-dienyl]-1,3-benzoxazole (PubChem CID 155530957) has the molecular formula C17H14N2O and a molecular weight of 262.31 g/mol. Its IUPAC name is 5-methyl-2-[(1E,3E)-4-pyridin-4-ylbuta-1,3-dienyl]-1,3-benzoxazole.
| Compound Name | 5-methyl-2-[(1E,3E)-4-pyridin-4-ylbuta-1,3-dienyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 155530957 |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 5-methyl-2-[(1E,3E)-4-pyridin-4-ylbuta-1,3-dienyl]-1,3-benzoxazole |
| SMILES | Cc1ccc2oc(/C=C/C=C/c3ccncc3)nc2c1 |
| InChI | InChI=1S/C17H14N2O/c1-13-6-7-16-15(12-13)19-17(20-16)5-3-2-4-14-8-10-18-11-9-14/h2-12H,1H3/b4-2+,5-3+ |
| InChIKey | OGJMUAMXSPQQDP-ZUVMSYQZSA-N |
| XLogP | 4.26 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|