C19H15N3O3S — CID 155533132
7-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methoxy]-4-phenylchromen-2-one (PubChem CID 155533132) has the molecular formula C19H15N3O3S and a molecular weight of 365.41 g/mol. Its IUPAC name is 7-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methoxy]-4-phenylchromen-2-one.
| Compound Name | 7-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methoxy]-4-phenylchromen-2-one |
|---|---|
| PubChem CID | 155533132 |
| Molecular Formula | C19H15N3O3S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 7-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methoxy]-4-phenylchromen-2-one |
| SMILES | Cn1c(COc2ccc3c(-c4ccccc4)cc(=O)oc3c2)n[nH]c1=S |
| InChI | InChI=1S/C19H15N3O3S/c1-22-17(20-21-19(22)26)11-24-13-7-8-14-15(12-5-3-2-4-6-12)10-18(23)25-16(14)9-13/h2-10H,11H2,1H3,(H,21,26) |
| InChIKey | DALMNDDQUTVKKD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|