C28H36N8O2S — CID 155533268
7-cyclopentyl-2-[[5-(7-isothiocyanatoheptylcarbamoyl)-2-pyridinyl]amino]-N,N-dimethylpyrrolo[2,3-d]pyrimidine-6-carboxamide (PubChem CID 155533268) has the molecular formula C28H36N8O2S and a molecular weight of 548.72 g/mol. Its IUPAC name is 7-cyclopentyl-2-[[5-(7-isothiocyanatoheptylcarbamoyl)-2-pyridinyl]amino]-N,N-dimethylpyrrolo[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 7-cyclopentyl-2-[[5-(7-isothiocyanatoheptylcarbamoyl)-2-pyridinyl]amino]-N,N-dimethylpyrrolo[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 155533268 |
| Molecular Formula | C28H36N8O2S |
| Molecular Weight | 548.72 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | 7-cyclopentyl-2-[[5-(7-isothiocyanatoheptylcarbamoyl)-2-pyridinyl]amino]-N,N-dimethylpyrrolo[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CN(C)C(=O)c1cc2cnc(Nc3ccc(C(=O)NCCCCCCCN=C=S)cn3)nc2n1C1CCCC1 |
| InChI | InChI=1S/C28H36N8O2S/c1-35(2)27(38)23-16-21-18-32-28(34-25(21)36(23)22-10-6-7-11-22)33-24-13-12-20(17-31-24)26(37)30-15-9-5-3-4-8-14-29-19-39/h12-13,16-18,22H,3-11,14-15H2,1-2H3,(H,30,37)(H,31,32,33,34) |
| InChIKey | RPWOBEQDJXSYJB-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 117.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.72 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|