C29H34N6O5S — CID 176885879
3-[[6-[[7-cyclopentyl-6-(dimethylcarbamoyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]-3-pyridinyl]oxy]propyl 4-methylbenzenesulfonate (PubChem CID 176885879) has the molecular formula C29H34N6O5S and a molecular weight of 578.70 g/mol. Its IUPAC name is 3-[[6-[[7-cyclopentyl-6-(dimethylcarbamoyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]-3-pyridinyl]oxy]propyl 4-methylbenzenesulfonate.
| Compound Name | 3-[[6-[[7-cyclopentyl-6-(dimethylcarbamoyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]-3-pyridinyl]oxy]propyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 176885879 |
| Molecular Formula | C29H34N6O5S |
| Molecular Weight | 578.70 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | 3-[[6-[[7-cyclopentyl-6-(dimethylcarbamoyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]-3-pyridinyl]oxy]propyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCOc2ccc(Nc3ncc4cc(C(=O)N(C)C)n(C5CCCC5)c4n3)nc2)cc1 |
| InChI | InChI=1S/C29H34N6O5S/c1-20-9-12-24(13-10-20)41(37,38)40-16-6-15-39-23-11-14-26(30-19-23)32-29-31-18-21-17-25(28(36)34(2)3)35(27(21)33-29)22-7-4-5-8-22/h9-14,17-19,22H,4-8,15-16H2,1-3H3,(H,30,31,32,33) |
| InChIKey | HXGVOZVFEBKEIW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.70 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|