C29H38ClN5O — CID 155533588
6-chloro-N-[[4-[4-(2-cyclohexylethyl)piperazin-1-yl]phenyl]methyl]-2-ethylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 155533588) has the molecular formula C29H38ClN5O and a molecular weight of 508.11 g/mol. Its IUPAC name is 6-chloro-N-[[4-[4-(2-cyclohexylethyl)piperazin-1-yl]phenyl]methyl]-2-ethylimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[[4-[4-(2-cyclohexylethyl)piperazin-1-yl]phenyl]methyl]-2-ethylimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155533588 |
| Molecular Formula | C29H38ClN5O |
| Molecular Weight | 508.11 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | 6-chloro-N-[[4-[4-(2-cyclohexylethyl)piperazin-1-yl]phenyl]methyl]-2-ethylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CCc1nc2ccc(Cl)cn2c1C(=O)NCc1ccc(N2CCN(CCC3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C29H38ClN5O/c1-2-26-28(35-21-24(30)10-13-27(35)32-26)29(36)31-20-23-8-11-25(12-9-23)34-18-16-33(17-19-34)15-14-22-6-4-3-5-7-22/h8-13,21-22H,2-7,14-20H2,1H3,(H,31,36) |
| InChIKey | SECSVJXOSSXEIW-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 52.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.11 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|