C23H19N3O4 — CID 155534637
4-[5-[(4,5-dimethyl-2-nitrophenyl)methyl]indazol-1-yl]benzoic acid (PubChem CID 155534637) has the molecular formula C23H19N3O4 and a molecular weight of 401.42 g/mol. Its IUPAC name is 4-[5-[(4,5-dimethyl-2-nitrophenyl)methyl]indazol-1-yl]benzoic acid.
| Compound Name | 4-[5-[(4,5-dimethyl-2-nitrophenyl)methyl]indazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 155534637 |
| Molecular Formula | C23H19N3O4 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 4-[5-[(4,5-dimethyl-2-nitrophenyl)methyl]indazol-1-yl]benzoic acid |
| SMILES | Cc1cc(Cc2ccc3c(cnn3-c3ccc(C(=O)O)cc3)c2)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C23H19N3O4/c1-14-9-18(22(26(29)30)10-15(14)2)11-16-3-8-21-19(12-16)13-24-25(21)20-6-4-17(5-7-20)23(27)28/h3-10,12-13H,11H2,1-2H3,(H,27,28) |
| InChIKey | UXQNHNWPHKBBDY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|