C22H19ClN4O2S — CID 155534794
5-methyl-4-(1-naphthalen-1-ylsulfonylindol-3-yl)-1H-imidazol-2-amine;hydrochloride (PubChem CID 155534794) has the molecular formula C22H19ClN4O2S and a molecular weight of 438.94 g/mol. Its IUPAC name is 5-methyl-4-(1-naphthalen-1-ylsulfonylindol-3-yl)-1H-imidazol-2-amine;hydrochloride.
| Compound Name | 5-methyl-4-(1-naphthalen-1-ylsulfonylindol-3-yl)-1H-imidazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 155534794 |
| Molecular Formula | C22H19ClN4O2S |
| Molecular Weight | 438.94 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 5-methyl-4-(1-naphthalen-1-ylsulfonylindol-3-yl)-1H-imidazol-2-amine;hydrochloride |
| SMILES | Cc1[nH]c(N)nc1-c1cn(S(=O)(=O)c2cccc3ccccc23)c2ccccc12.Cl |
| InChI | InChI=1S/C22H18N4O2S.ClH/c1-14-21(25-22(23)24-14)18-13-26(19-11-5-4-10-17(18)19)29(27,28)20-12-6-8-15-7-2-3-9-16(15)20;/h2-13H,1H3,(H3,23,24,25);1H |
| InChIKey | NGGMVVFXCYBTPP-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 93.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.94 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |