C31H35NO8S2 — CID 155535090
ethyl (E)-2-[4-[(3R,4R)-1-benzyl-4-[4-[(E)-2-ethoxysulfonylethenyl]phenoxy]pyrrolidin-3-yl]oxyphenyl]ethenesulfonate (PubChem CID 155535090) has the molecular formula C31H35NO8S2 and a molecular weight of 613.75 g/mol. Its IUPAC name is ethyl (E)-2-[4-[(3R,4R)-1-benzyl-4-[4-[(E)-2-ethoxysulfonylethenyl]phenoxy]pyrrolidin-3-yl]oxyphenyl]ethenesulfonate.
| Compound Name | ethyl (E)-2-[4-[(3R,4R)-1-benzyl-4-[4-[(E)-2-ethoxysulfonylethenyl]phenoxy]pyrrolidin-3-yl]oxyphenyl]ethenesulfonate |
|---|---|
| PubChem CID | 155535090 |
| Molecular Formula | C31H35NO8S2 |
| Molecular Weight | 613.75 g/mol |
| Exact Mass | 613.18 |
| IUPAC Name | ethyl (E)-2-[4-[(3R,4R)-1-benzyl-4-[4-[(E)-2-ethoxysulfonylethenyl]phenoxy]pyrrolidin-3-yl]oxyphenyl]ethenesulfonate |
| SMILES | CCOS(=O)(=O)/C=C/c1ccc(O[C@@H]2CN(Cc3ccccc3)C[C@H]2Oc2ccc(/C=C/S(=O)(=O)OCC)cc2)cc1 |
| InChI | InChI=1S/C31H35NO8S2/c1-3-37-41(33,34)20-18-25-10-14-28(15-11-25)39-30-23-32(22-27-8-6-5-7-9-27)24-31(30)40-29-16-12-26(13-17-29)19-21-42(35,36)38-4-2/h5-21,30-31H,3-4,22-24H2,1-2H3/b20-18+,21-19+/t30-,31-/m1/s1 |
| InChIKey | IOUNUJXZUMKRAG-NSIIJTINSA-N |
| XLogP | 5.07 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.75 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|