C19H17FN2O3S — CID 155535946
2-[2-fluoro-4-[(5-methyl-2-phenyl-1,3-thiazol-4-yl)methylamino]phenoxy]acetic acid (PubChem CID 155535946) has the molecular formula C19H17FN2O3S and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-[2-fluoro-4-[(5-methyl-2-phenyl-1,3-thiazol-4-yl)methylamino]phenoxy]acetic acid.
| Compound Name | 2-[2-fluoro-4-[(5-methyl-2-phenyl-1,3-thiazol-4-yl)methylamino]phenoxy]acetic acid |
|---|---|
| PubChem CID | 155535946 |
| Molecular Formula | C19H17FN2O3S |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 2-[2-fluoro-4-[(5-methyl-2-phenyl-1,3-thiazol-4-yl)methylamino]phenoxy]acetic acid |
| SMILES | Cc1sc(-c2ccccc2)nc1CNc1ccc(OCC(=O)O)c(F)c1 |
| InChI | InChI=1S/C19H17FN2O3S/c1-12-16(22-19(26-12)13-5-3-2-4-6-13)10-21-14-7-8-17(15(20)9-14)25-11-18(23)24/h2-9,21H,10-11H2,1H3,(H,23,24) |
| InChIKey | DQDINMREBATABW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|