C19H18Cl2N2O3 — CID 155537258
1,2-dichloro-6-(2-morpholin-4-ylethoxy)-10H-acridin-9-one (PubChem CID 155537258) has the molecular formula C19H18Cl2N2O3 and a molecular weight of 393.27 g/mol. Its IUPAC name is 1,2-dichloro-6-(2-morpholin-4-ylethoxy)-10H-acridin-9-one.
| Compound Name | 1,2-dichloro-6-(2-morpholin-4-ylethoxy)-10H-acridin-9-one |
|---|---|
| PubChem CID | 155537258 |
| Molecular Formula | C19H18Cl2N2O3 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 1,2-dichloro-6-(2-morpholin-4-ylethoxy)-10H-acridin-9-one |
| SMILES | O=c1c2ccc(OCCN3CCOCC3)cc2[nH]c2ccc(Cl)c(Cl)c12 |
| InChI | InChI=1S/C19H18Cl2N2O3/c20-14-3-4-15-17(18(14)21)19(24)13-2-1-12(11-16(13)22-15)26-10-7-23-5-8-25-9-6-23/h1-4,11H,5-10H2,(H,22,24) |
| InChIKey | PXMQBGCGHFSUEE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|