C20H24N5O5PS — CID 155537695
N'-[diethoxyphosphoryl(phenyl)methyl]-2-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetohydrazide (PubChem CID 155537695) has the molecular formula C20H24N5O5PS and a molecular weight of 477.48 g/mol. Its IUPAC name is N'-[diethoxyphosphoryl(phenyl)methyl]-2-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetohydrazide.
| Compound Name | N'-[diethoxyphosphoryl(phenyl)methyl]-2-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetohydrazide |
|---|---|
| PubChem CID | 155537695 |
| Molecular Formula | C20H24N5O5PS |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | N'-[diethoxyphosphoryl(phenyl)methyl]-2-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetohydrazide |
| SMILES | CCOP(=O)(OCC)C(NNC(=O)CSc1nnc(-c2ccncc2)o1)c1ccccc1 |
| InChI | InChI=1S/C20H24N5O5PS/c1-3-28-31(27,29-4-2)19(16-8-6-5-7-9-16)24-22-17(26)14-32-20-25-23-18(30-20)15-10-12-21-13-11-15/h5-13,19,24H,3-4,14H2,1-2H3,(H,22,26) |
| InChIKey | DAFNBWQXWQSQGM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 128.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|