C20H23N6O7PS — CID 155566270
N'-[diethoxyphosphoryl-(4-nitrophenyl)methyl]-2-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetohydrazide (PubChem CID 155566270) has the molecular formula C20H23N6O7PS and a molecular weight of 522.48 g/mol. Its IUPAC name is N'-[diethoxyphosphoryl-(4-nitrophenyl)methyl]-2-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetohydrazide.
| Compound Name | N'-[diethoxyphosphoryl-(4-nitrophenyl)methyl]-2-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetohydrazide |
|---|---|
| PubChem CID | 155566270 |
| Molecular Formula | C20H23N6O7PS |
| Molecular Weight | 522.48 g/mol |
| Exact Mass | 522.11 |
| IUPAC Name | N'-[diethoxyphosphoryl-(4-nitrophenyl)methyl]-2-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetohydrazide |
| SMILES | CCOP(=O)(OCC)C(NNC(=O)CSc1nnc(-c2ccncc2)o1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H23N6O7PS/c1-3-31-34(30,32-4-2)19(15-5-7-16(8-6-15)26(28)29)24-22-17(27)13-35-20-25-23-18(33-20)14-9-11-21-12-10-14/h5-12,19,24H,3-4,13H2,1-2H3,(H,22,27) |
| InChIKey | RGUBFTTWGFHIPQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 171.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|