C27H26N8O2 — CID 155537712
5-[6-(methylamino)pyrazin-2-yl]-N-(4-morpholin-4-ylphenyl)-4-phenoxy-7H-pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 155537712) has the molecular formula C27H26N8O2 and a molecular weight of 494.56 g/mol. Its IUPAC name is 5-[6-(methylamino)pyrazin-2-yl]-N-(4-morpholin-4-ylphenyl)-4-phenoxy-7H-pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 5-[6-(methylamino)pyrazin-2-yl]-N-(4-morpholin-4-ylphenyl)-4-phenoxy-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 155537712 |
| Molecular Formula | C27H26N8O2 |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 5-[6-(methylamino)pyrazin-2-yl]-N-(4-morpholin-4-ylphenyl)-4-phenoxy-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | CNc1cncc(-c2c[nH]c3nc(Nc4ccc(N5CCOCC5)cc4)nc(Oc4ccccc4)c23)n1 |
| InChI | InChI=1S/C27H26N8O2/c1-28-23-17-29-16-22(32-23)21-15-30-25-24(21)26(37-20-5-3-2-4-6-20)34-27(33-25)31-18-7-9-19(10-8-18)35-11-13-36-14-12-35/h2-10,15-17H,11-14H2,1H3,(H,28,32)(H2,30,31,33,34) |
| InChIKey | UOQCFTKTVCSBCO-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 113.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|