C31H37NO5S — CID 155538107
[(8S,9S,13S,14S)-17-[(2E)-2-ethoxy-2-(4-methylphenyl)sulfonyliminoethyl]-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 155538107) has the molecular formula C31H37NO5S and a molecular weight of 535.71 g/mol. Its IUPAC name is [(8S,9S,13S,14S)-17-[(2E)-2-ethoxy-2-(4-methylphenyl)sulfonyliminoethyl]-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(8S,9S,13S,14S)-17-[(2E)-2-ethoxy-2-(4-methylphenyl)sulfonyliminoethyl]-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 155538107 |
| Molecular Formula | C31H37NO5S |
| Molecular Weight | 535.71 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | [(8S,9S,13S,14S)-17-[(2E)-2-ethoxy-2-(4-methylphenyl)sulfonyliminoethyl]-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CCO/C(CC1=CC[C@H]2[C@@H]3CCc4cc(OC(C)=O)ccc4[C@H]3CC[C@]12C)=N/S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C31H37NO5S/c1-5-36-30(32-38(34,35)25-11-6-20(2)7-12-25)19-23-9-15-29-28-13-8-22-18-24(37-21(3)33)10-14-26(22)27(28)16-17-31(23,29)4/h6-7,9-12,14,18,27-29H,5,8,13,15-17,19H2,1-4H3/b32-30+/t27-,28-,29+,31-/m1/s1 |
| InChIKey | OYIHVIBBCJENGQ-DLUGTPKKSA-N |
| XLogP | 6.53 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.71 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|