C32H43NO5S — CID 155536151
propan-2-yl (1E)-2-[(8R,9S,13S,14S,17R)-3,17-dimethoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-N-(4-methylphenyl)sulfonylethanimidate (PubChem CID 155536151) has the molecular formula C32H43NO5S and a molecular weight of 553.77 g/mol. Its IUPAC name is propan-2-yl (1E)-2-[(8R,9S,13S,14S,17R)-3,17-dimethoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-N-(4-methylphenyl)sulfonylethanimidate.
| Compound Name | propan-2-yl (1E)-2-[(8R,9S,13S,14S,17R)-3,17-dimethoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-N-(4-methylphenyl)sulfonylethanimidate |
|---|---|
| PubChem CID | 155536151 |
| Molecular Formula | C32H43NO5S |
| Molecular Weight | 553.77 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | propan-2-yl (1E)-2-[(8R,9S,13S,14S,17R)-3,17-dimethoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-N-(4-methylphenyl)sulfonylethanimidate |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@]2(C/C(=N\S(=O)(=O)c1ccc(C)cc1)OC(C)C)OC |
| InChI | InChI=1S/C32H43NO5S/c1-21(2)38-30(33-39(34,35)25-11-7-22(3)8-12-25)20-32(37-6)18-16-29-28-13-9-23-19-24(36-5)10-14-26(23)27(28)15-17-31(29,32)4/h7-8,10-12,14,19,21,27-29H,9,13,15-18,20H2,1-6H3/b33-30+/t27-,28-,29+,31+,32-/m1/s1 |
| InChIKey | RLYVIPPSBWVKOS-VUEYLNPHSA-N |
| XLogP | 6.85 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.77 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|