C24H16FNO2 — CID 155538577
2-(3-fluorophenyl)-4-(3-hydroxyphenyl)-5H-indeno[1,2-b]pyridin-9-ol (PubChem CID 155538577) has the molecular formula C24H16FNO2 and a molecular weight of 369.40 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-4-(3-hydroxyphenyl)-5H-indeno[1,2-b]pyridin-9-ol.
| Compound Name | 2-(3-fluorophenyl)-4-(3-hydroxyphenyl)-5H-indeno[1,2-b]pyridin-9-ol |
|---|---|
| PubChem CID | 155538577 |
| Molecular Formula | C24H16FNO2 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2-(3-fluorophenyl)-4-(3-hydroxyphenyl)-5H-indeno[1,2-b]pyridin-9-ol |
| SMILES | Oc1cccc(-c2cc(-c3cccc(F)c3)nc3c2Cc2cccc(O)c2-3)c1 |
| InChI | InChI=1S/C24H16FNO2/c25-17-7-1-5-15(10-17)21-13-19(14-4-2-8-18(27)11-14)20-12-16-6-3-9-22(28)23(16)24(20)26-21/h1-11,13,27-28H,12H2 |
| InChIKey | ZALQNGMCJMLOLB-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |