C18H14ClN3O2 — CID 155538726
4-(4-chlorobenzoyl)-N-(pyridin-4-ylmethyl)-1H-pyrrole-2-carboxamide (PubChem CID 155538726) has the molecular formula C18H14ClN3O2 and a molecular weight of 339.78 g/mol. Its IUPAC name is 4-(4-chlorobenzoyl)-N-(pyridin-4-ylmethyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-(4-chlorobenzoyl)-N-(pyridin-4-ylmethyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 155538726 |
| Molecular Formula | C18H14ClN3O2 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 4-(4-chlorobenzoyl)-N-(pyridin-4-ylmethyl)-1H-pyrrole-2-carboxamide |
| SMILES | O=C(c1ccc(Cl)cc1)c1c[nH]c(C(=O)NCc2ccncc2)c1 |
| InChI | InChI=1S/C18H14ClN3O2/c19-15-3-1-13(2-4-15)17(23)14-9-16(21-11-14)18(24)22-10-12-5-7-20-8-6-12/h1-9,11,21H,10H2,(H,22,24) |
| InChIKey | RMJIMUCQQGEVKQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |