C17H13N3OS — CID 155538840
[4-(6-thiophen-2-ylimidazo[1,2-a]pyrazin-3-yl)phenyl]methanol (PubChem CID 155538840) has the molecular formula C17H13N3OS and a molecular weight of 307.38 g/mol. Its IUPAC name is [4-(6-thiophen-2-ylimidazo[1,2-a]pyrazin-3-yl)phenyl]methanol.
| Compound Name | [4-(6-thiophen-2-ylimidazo[1,2-a]pyrazin-3-yl)phenyl]methanol |
|---|---|
| PubChem CID | 155538840 |
| Molecular Formula | C17H13N3OS |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | [4-(6-thiophen-2-ylimidazo[1,2-a]pyrazin-3-yl)phenyl]methanol |
| SMILES | OCc1ccc(-c2cnc3cnc(-c4cccs4)cn23)cc1 |
| InChI | InChI=1S/C17H13N3OS/c21-11-12-3-5-13(6-4-12)15-8-19-17-9-18-14(10-20(15)17)16-2-1-7-22-16/h1-10,21H,11H2 |
| InChIKey | FQKHLWWMEPWWCM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |