C26H24FN3O4 — CID 155539448
N-(3-fluorophenyl)-5-methoxy-2-[[4-(2-oxopiperidin-1-yl)benzoyl]amino]benzamide (PubChem CID 155539448) has the molecular formula C26H24FN3O4 and a molecular weight of 461.49 g/mol. Its IUPAC name is N-(3-fluorophenyl)-5-methoxy-2-[[4-(2-oxopiperidin-1-yl)benzoyl]amino]benzamide.
| Compound Name | N-(3-fluorophenyl)-5-methoxy-2-[[4-(2-oxopiperidin-1-yl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 155539448 |
| Molecular Formula | C26H24FN3O4 |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | N-(3-fluorophenyl)-5-methoxy-2-[[4-(2-oxopiperidin-1-yl)benzoyl]amino]benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(N3CCCCC3=O)cc2)c(C(=O)Nc2cccc(F)c2)c1 |
| InChI | InChI=1S/C26H24FN3O4/c1-34-21-12-13-23(22(16-21)26(33)28-19-6-4-5-18(27)15-19)29-25(32)17-8-10-20(11-9-17)30-14-3-2-7-24(30)31/h4-6,8-13,15-16H,2-3,7,14H2,1H3,(H,28,33)(H,29,32) |
| InChIKey | PUFNFHHLLDPUQV-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |