C27H27N3O5 — CID 155513899
5-methoxy-N-(2-methoxyphenyl)-2-[[4-(2-oxopiperidin-1-yl)benzoyl]amino]benzamide (PubChem CID 155513899) has the molecular formula C27H27N3O5 and a molecular weight of 473.53 g/mol. Its IUPAC name is 5-methoxy-N-(2-methoxyphenyl)-2-[[4-(2-oxopiperidin-1-yl)benzoyl]amino]benzamide.
| Compound Name | 5-methoxy-N-(2-methoxyphenyl)-2-[[4-(2-oxopiperidin-1-yl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 155513899 |
| Molecular Formula | C27H27N3O5 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 5-methoxy-N-(2-methoxyphenyl)-2-[[4-(2-oxopiperidin-1-yl)benzoyl]amino]benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(N3CCCCC3=O)cc2)c(C(=O)Nc2ccccc2OC)c1 |
| InChI | InChI=1S/C27H27N3O5/c1-34-20-14-15-22(21(17-20)27(33)29-23-7-3-4-8-24(23)35-2)28-26(32)18-10-12-19(13-11-18)30-16-6-5-9-25(30)31/h3-4,7-8,10-15,17H,5-6,9,16H2,1-2H3,(H,28,32)(H,29,33) |
| InChIKey | OHICMTZVGVGNOH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |