C20H28N2O3 — CID 155540156
methyl (2S)-3-methyl-2-[(1-pentylindole-2-carbonyl)amino]butanoate (PubChem CID 155540156) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is methyl (2S)-3-methyl-2-[(1-pentylindole-2-carbonyl)amino]butanoate.
| Compound Name | methyl (2S)-3-methyl-2-[(1-pentylindole-2-carbonyl)amino]butanoate |
|---|---|
| PubChem CID | 155540156 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | methyl (2S)-3-methyl-2-[(1-pentylindole-2-carbonyl)amino]butanoate |
| SMILES | CCCCCn1c(C(=O)N[C@H](C(=O)OC)C(C)C)cc2ccccc21 |
| InChI | InChI=1S/C20H28N2O3/c1-5-6-9-12-22-16-11-8-7-10-15(16)13-17(22)19(23)21-18(14(2)3)20(24)25-4/h7-8,10-11,13-14,18H,5-6,9,12H2,1-4H3,(H,21,23)/t18-/m0/s1 |
| InChIKey | FTECAZGVBHXMMG-SFHVURJKSA-N |
| XLogP | 3.76 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|