C27H39N5O6 — CID 67564709
4-amino-3-[[4-amino-2-[(1-decylindole-2-carbonyl)amino]-4-oxobutanoyl]amino]-4-oxobutanoic acid (PubChem CID 67564709) has the molecular formula C27H39N5O6 and a molecular weight of 529.64 g/mol. Its IUPAC name is 4-amino-3-[[4-amino-2-[(1-decylindole-2-carbonyl)amino]-4-oxobutanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-3-[[4-amino-2-[(1-decylindole-2-carbonyl)amino]-4-oxobutanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 67564709 |
| Molecular Formula | C27H39N5O6 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.29 |
| IUPAC Name | 4-amino-3-[[4-amino-2-[(1-decylindole-2-carbonyl)amino]-4-oxobutanoyl]amino]-4-oxobutanoic acid |
| SMILES | CCCCCCCCCCn1c(C(=O)NC(CC(N)=O)C(=O)NC(CC(=O)O)C(N)=O)cc2ccccc21 |
| InChI | InChI=1S/C27H39N5O6/c1-2-3-4-5-6-7-8-11-14-32-21-13-10-9-12-18(21)15-22(32)27(38)31-20(16-23(28)33)26(37)30-19(25(29)36)17-24(34)35/h9-10,12-13,15,19-20H,2-8,11,14,16-17H2,1H3,(H2,28,33)(H2,29,36)(H,30,37)(H,31,38)(H,34,35) |
| InChIKey | MKXRCTSCLJTSGL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 186.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|