C34H52N6O7 — CID 59065005
3-[[2-[[2-acetamido-3-(1-decylindol-3-yl)propanoyl]amino]-4-amino-4-oxobutanoyl]amino]-4-oxo-4-(propan-2-ylamino)butanoic acid (PubChem CID 59065005) has the molecular formula C34H52N6O7 and a molecular weight of 656.83 g/mol. Its IUPAC name is 3-[[2-[[2-acetamido-3-(1-decylindol-3-yl)propanoyl]amino]-4-amino-4-oxobutanoyl]amino]-4-oxo-4-(propan-2-ylamino)butanoic acid.
| Compound Name | 3-[[2-[[2-acetamido-3-(1-decylindol-3-yl)propanoyl]amino]-4-amino-4-oxobutanoyl]amino]-4-oxo-4-(propan-2-ylamino)butanoic acid |
|---|---|
| PubChem CID | 59065005 |
| Molecular Formula | C34H52N6O7 |
| Molecular Weight | 656.83 g/mol |
| Exact Mass | 656.39 |
| IUPAC Name | 3-[[2-[[2-acetamido-3-(1-decylindol-3-yl)propanoyl]amino]-4-amino-4-oxobutanoyl]amino]-4-oxo-4-(propan-2-ylamino)butanoic acid |
| SMILES | CCCCCCCCCCn1cc(CC(NC(C)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC(=O)O)C(=O)NC(C)C)c2ccccc21 |
| InChI | InChI=1S/C34H52N6O7/c1-5-6-7-8-9-10-11-14-17-40-21-24(25-15-12-13-16-29(25)40)18-26(37-23(4)41)33(46)38-27(19-30(35)42)34(47)39-28(20-31(43)44)32(45)36-22(2)3/h12-13,15-16,21-22,26-28H,5-11,14,17-20H2,1-4H3,(H2,35,42)(H,36,45)(H,37,41)(H,38,46)(H,39,47)(H,43,44) |
| InChIKey | BUUKZPKJNRXVTA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 201.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.83 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|