C35H43N5O7 — CID 90720526
3-[[4-amino-2-[[3-(1H-indol-3-yl)-2-[3-(4-pentylphenyl)but-2-enoylamino]propanoyl]amino]-4-oxobutanoyl]amino]-4-oxopentanoic acid (PubChem CID 90720526) has the molecular formula C35H43N5O7 and a molecular weight of 645.76 g/mol. Its IUPAC name is 3-[[4-amino-2-[[3-(1H-indol-3-yl)-2-[3-(4-pentylphenyl)but-2-enoylamino]propanoyl]amino]-4-oxobutanoyl]amino]-4-oxopentanoic acid.
| Compound Name | 3-[[4-amino-2-[[3-(1H-indol-3-yl)-2-[3-(4-pentylphenyl)but-2-enoylamino]propanoyl]amino]-4-oxobutanoyl]amino]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 90720526 |
| Molecular Formula | C35H43N5O7 |
| Molecular Weight | 645.76 g/mol |
| Exact Mass | 645.32 |
| IUPAC Name | 3-[[4-amino-2-[[3-(1H-indol-3-yl)-2-[3-(4-pentylphenyl)but-2-enoylamino]propanoyl]amino]-4-oxobutanoyl]amino]-4-oxopentanoic acid |
| SMILES | CCCCCc1ccc(C(C)=CC(=O)NC(Cc2c[nH]c3ccccc23)C(=O)NC(CC(N)=O)C(=O)NC(CC(=O)O)C(C)=O)cc1 |
| InChI | InChI=1S/C35H43N5O7/c1-4-5-6-9-23-12-14-24(15-13-23)21(2)16-32(43)38-29(17-25-20-37-27-11-8-7-10-26(25)27)34(46)40-30(18-31(36)42)35(47)39-28(22(3)41)19-33(44)45/h7-8,10-16,20,28-30,37H,4-6,9,17-19H2,1-3H3,(H2,36,42)(H,38,43)(H,39,47)(H,40,46)(H,44,45) |
| InChIKey | TZORYEIASRFISY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 200.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.76 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|