C38H53ClN4O5 — CID 57225590
methyl (5S)-6-[[(3S)-1-amino-1-oxododecan-3-yl]-propylamino]-5-[[1-[(2-chlorophenyl)methyl]indole-2-carbonyl]amino]-6-oxohexanoate (PubChem CID 57225590) has the molecular formula C38H53ClN4O5 and a molecular weight of 681.32 g/mol. Its IUPAC name is methyl (5S)-6-[[(3S)-1-amino-1-oxododecan-3-yl]-propylamino]-5-[[1-[(2-chlorophenyl)methyl]indole-2-carbonyl]amino]-6-oxohexanoate.
| Compound Name | methyl (5S)-6-[[(3S)-1-amino-1-oxododecan-3-yl]-propylamino]-5-[[1-[(2-chlorophenyl)methyl]indole-2-carbonyl]amino]-6-oxohexanoate |
|---|---|
| PubChem CID | 57225590 |
| Molecular Formula | C38H53ClN4O5 |
| Molecular Weight | 681.32 g/mol |
| Exact Mass | 680.37 |
| IUPAC Name | methyl (5S)-6-[[(3S)-1-amino-1-oxododecan-3-yl]-propylamino]-5-[[1-[(2-chlorophenyl)methyl]indole-2-carbonyl]amino]-6-oxohexanoate |
| SMILES | CCCCCCCCC[C@@H](CC(N)=O)N(CCC)C(=O)[C@H](CCCC(=O)OC)NC(=O)c1cc2ccccc2n1Cc1ccccc1Cl |
| InChI | InChI=1S/C38H53ClN4O5/c1-4-6-7-8-9-10-11-19-30(26-35(40)44)42(24-5-2)38(47)32(21-16-23-36(45)48-3)41-37(46)34-25-28-17-13-15-22-33(28)43(34)27-29-18-12-14-20-31(29)39/h12-15,17-18,20,22,25,30,32H,4-11,16,19,21,23-24,26-27H2,1-3H3,(H2,40,44)(H,41,46)/t30-,32-/m0/s1 |
| InChIKey | GKPFVVBRIDPQIE-CDZUIXILSA-N |
| XLogP | 7.41 |
| TPSA | 123.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.32 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|