C49H54N4O5 — CID 57068156
benzyl (5S)-6-[[(2S)-4-amino-1-(6-ethylnaphthalen-2-yl)-4-oxobutan-2-yl]-butylamino]-5-[(1-benzylindole-3-carbonyl)amino]-6-oxohexanoate (PubChem CID 57068156) has the molecular formula C49H54N4O5 and a molecular weight of 778.99 g/mol. Its IUPAC name is benzyl (5S)-6-[[(2S)-4-amino-1-(6-ethylnaphthalen-2-yl)-4-oxobutan-2-yl]-butylamino]-5-[(1-benzylindole-3-carbonyl)amino]-6-oxohexanoate.
| Compound Name | benzyl (5S)-6-[[(2S)-4-amino-1-(6-ethylnaphthalen-2-yl)-4-oxobutan-2-yl]-butylamino]-5-[(1-benzylindole-3-carbonyl)amino]-6-oxohexanoate |
|---|---|
| PubChem CID | 57068156 |
| Molecular Formula | C49H54N4O5 |
| Molecular Weight | 778.99 g/mol |
| Exact Mass | 778.41 |
| IUPAC Name | benzyl (5S)-6-[[(2S)-4-amino-1-(6-ethylnaphthalen-2-yl)-4-oxobutan-2-yl]-butylamino]-5-[(1-benzylindole-3-carbonyl)amino]-6-oxohexanoate |
| SMILES | CCCCN(C(=O)[C@H](CCCC(=O)OCc1ccccc1)NC(=O)c1cn(Cc2ccccc2)c2ccccc12)[C@H](CC(N)=O)Cc1ccc2cc(CC)ccc2c1 |
| InChI | InChI=1S/C49H54N4O5/c1-3-5-27-53(41(31-46(50)54)30-38-24-26-39-28-35(4-2)23-25-40(39)29-38)49(57)44(20-14-22-47(55)58-34-37-17-10-7-11-18-37)51-48(56)43-33-52(32-36-15-8-6-9-16-36)45-21-13-12-19-42(43)45/h6-13,15-19,21,23-26,28-29,33,41,44H,3-5,14,20,22,27,30-32,34H2,1-2H3,(H2,50,54)(H,51,56)/t41-,44-/m0/s1 |
| InChIKey | XZAHJWZLSTYMRM-XKKDUZJHSA-N |
| XLogP | 8.53 |
| TPSA | 123.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.99 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |