C40H50N4O5 — CID 57313353
(5S)-6-[[(2S)-4-amino-3-(4-butylphenyl)-4-oxobutan-2-yl]-butylamino]-5-[(1-benzylindole-3-carbonyl)amino]-6-oxohexanoic acid (PubChem CID 57313353) has the molecular formula C40H50N4O5 and a molecular weight of 666.86 g/mol. Its IUPAC name is (5S)-6-[[(2S)-4-amino-3-(4-butylphenyl)-4-oxobutan-2-yl]-butylamino]-5-[(1-benzylindole-3-carbonyl)amino]-6-oxohexanoic acid.
| Compound Name | (5S)-6-[[(2S)-4-amino-3-(4-butylphenyl)-4-oxobutan-2-yl]-butylamino]-5-[(1-benzylindole-3-carbonyl)amino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 57313353 |
| Molecular Formula | C40H50N4O5 |
| Molecular Weight | 666.86 g/mol |
| Exact Mass | 666.38 |
| IUPAC Name | (5S)-6-[[(2S)-4-amino-3-(4-butylphenyl)-4-oxobutan-2-yl]-butylamino]-5-[(1-benzylindole-3-carbonyl)amino]-6-oxohexanoic acid |
| SMILES | CCCCc1ccc(C(C(N)=O)[C@H](C)N(CCCC)C(=O)[C@H](CCCC(=O)O)NC(=O)c2cn(Cc3ccccc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C40H50N4O5/c1-4-6-14-29-21-23-31(24-22-29)37(38(41)47)28(3)44(25-7-5-2)40(49)34(18-13-20-36(45)46)42-39(48)33-27-43(26-30-15-9-8-10-16-30)35-19-12-11-17-32(33)35/h8-12,15-17,19,21-24,27-28,34,37H,4-7,13-14,18,20,25-26H2,1-3H3,(H2,41,47)(H,42,48)(H,45,46)/t28-,34-,37?/m0/s1 |
| InChIKey | PLGDBECFJTYSDA-SJVPFVBJSA-N |
| XLogP | 6.67 |
| TPSA | 134.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.86 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |