C41H52N4O5 — CID 57274429
benzyl (5S)-6-[[(3S)-1-amino-1-oxononan-3-yl]-propylamino]-5-[(1-benzylindole-3-carbonyl)amino]-6-oxohexanoate (PubChem CID 57274429) has the molecular formula C41H52N4O5 and a molecular weight of 680.89 g/mol. Its IUPAC name is benzyl (5S)-6-[[(3S)-1-amino-1-oxononan-3-yl]-propylamino]-5-[(1-benzylindole-3-carbonyl)amino]-6-oxohexanoate.
| Compound Name | benzyl (5S)-6-[[(3S)-1-amino-1-oxononan-3-yl]-propylamino]-5-[(1-benzylindole-3-carbonyl)amino]-6-oxohexanoate |
|---|---|
| PubChem CID | 57274429 |
| Molecular Formula | C41H52N4O5 |
| Molecular Weight | 680.89 g/mol |
| Exact Mass | 680.39 |
| IUPAC Name | benzyl (5S)-6-[[(3S)-1-amino-1-oxononan-3-yl]-propylamino]-5-[(1-benzylindole-3-carbonyl)amino]-6-oxohexanoate |
| SMILES | CCCCCC[C@@H](CC(N)=O)N(CCC)C(=O)[C@H](CCCC(=O)OCc1ccccc1)NC(=O)c1cn(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C41H52N4O5/c1-3-5-6-13-21-33(27-38(42)46)45(26-4-2)41(49)36(23-16-25-39(47)50-30-32-19-11-8-12-20-32)43-40(48)35-29-44(28-31-17-9-7-10-18-31)37-24-15-14-22-34(35)37/h7-12,14-15,17-20,22,24,29,33,36H,3-6,13,16,21,23,25-28,30H2,1-2H3,(H2,42,46)(H,43,48)/t33-,36-/m0/s1 |
| InChIKey | HXXQVUILEICITK-JUKUECOXSA-N |
| XLogP | 7.15 |
| TPSA | 123.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.89 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|