C46H53ClN4O5 — CID 57028375
benzyl (5S)-6-[[(2S)-4-amino-1-(4-butylphenyl)-4-oxobutan-2-yl]-propylamino]-5-[[1-[(2-chlorophenyl)methyl]indole-3-carbonyl]amino]-6-oxohexanoate (PubChem CID 57028375) has the molecular formula C46H53ClN4O5 and a molecular weight of 777.41 g/mol. Its IUPAC name is benzyl (5S)-6-[[(2S)-4-amino-1-(4-butylphenyl)-4-oxobutan-2-yl]-propylamino]-5-[[1-[(2-chlorophenyl)methyl]indole-3-carbonyl]amino]-6-oxohexanoate.
| Compound Name | benzyl (5S)-6-[[(2S)-4-amino-1-(4-butylphenyl)-4-oxobutan-2-yl]-propylamino]-5-[[1-[(2-chlorophenyl)methyl]indole-3-carbonyl]amino]-6-oxohexanoate |
|---|---|
| PubChem CID | 57028375 |
| Molecular Formula | C46H53ClN4O5 |
| Molecular Weight | 777.41 g/mol |
| Exact Mass | 776.37 |
| IUPAC Name | benzyl (5S)-6-[[(2S)-4-amino-1-(4-butylphenyl)-4-oxobutan-2-yl]-propylamino]-5-[[1-[(2-chlorophenyl)methyl]indole-3-carbonyl]amino]-6-oxohexanoate |
| SMILES | CCCCc1ccc(C[C@@H](CC(N)=O)N(CCC)C(=O)[C@H](CCCC(=O)OCc2ccccc2)NC(=O)c2cn(Cc3ccccc3Cl)c3ccccc23)cc1 |
| InChI | InChI=1S/C46H53ClN4O5/c1-3-5-14-33-23-25-34(26-24-33)28-37(29-43(48)52)51(27-4-2)46(55)41(20-13-22-44(53)56-32-35-15-7-6-8-16-35)49-45(54)39-31-50(42-21-12-10-18-38(39)42)30-36-17-9-11-19-40(36)47/h6-12,15-19,21,23-26,31,37,41H,3-5,13-14,20,22,27-30,32H2,1-2H3,(H2,48,52)(H,49,54)/t37-,41-/m0/s1 |
| InChIKey | AYFBSWJCCSJGAL-IOPIWRGFSA-N |
| XLogP | 8.42 |
| TPSA | 123.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.41 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |