C41H51ClN4O5 — CID 57004367
benzyl (5S)-6-[[(3S)-1-amino-1-oxononan-3-yl]-propylamino]-5-[[1-[(2-chlorophenyl)methyl]indole-3-carbonyl]amino]-6-oxohexanoate (PubChem CID 57004367) has the molecular formula C41H51ClN4O5 and a molecular weight of 715.34 g/mol. Its IUPAC name is benzyl (5S)-6-[[(3S)-1-amino-1-oxononan-3-yl]-propylamino]-5-[[1-[(2-chlorophenyl)methyl]indole-3-carbonyl]amino]-6-oxohexanoate.
| Compound Name | benzyl (5S)-6-[[(3S)-1-amino-1-oxononan-3-yl]-propylamino]-5-[[1-[(2-chlorophenyl)methyl]indole-3-carbonyl]amino]-6-oxohexanoate |
|---|---|
| PubChem CID | 57004367 |
| Molecular Formula | C41H51ClN4O5 |
| Molecular Weight | 715.34 g/mol |
| Exact Mass | 714.35 |
| IUPAC Name | benzyl (5S)-6-[[(3S)-1-amino-1-oxononan-3-yl]-propylamino]-5-[[1-[(2-chlorophenyl)methyl]indole-3-carbonyl]amino]-6-oxohexanoate |
| SMILES | CCCCCC[C@@H](CC(N)=O)N(CCC)C(=O)[C@H](CCCC(=O)OCc1ccccc1)NC(=O)c1cn(Cc2ccccc2Cl)c2ccccc12 |
| InChI | InChI=1S/C41H51ClN4O5/c1-3-5-6-10-19-32(26-38(43)47)46(25-4-2)41(50)36(22-15-24-39(48)51-29-30-16-8-7-9-17-30)44-40(49)34-28-45(37-23-14-12-20-33(34)37)27-31-18-11-13-21-35(31)42/h7-9,11-14,16-18,20-21,23,28,32,36H,3-6,10,15,19,22,24-27,29H2,1-2H3,(H2,43,47)(H,44,49)/t32-,36-/m0/s1 |
| InChIKey | JUNHIWGEXHQWLK-IKYOIFQTSA-N |
| XLogP | 7.81 |
| TPSA | 123.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.34 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|