C38H39N3O6 — CID 57037562
(5S)-6-[(2S)-4-amino-1-(6-ethylnaphthalen-2-yl)-4-oxobutan-2-yl]oxy-5-[(1-benzylindole-2-carbonyl)amino]-6-oxohexanoic acid (PubChem CID 57037562) has the molecular formula C38H39N3O6 and a molecular weight of 633.75 g/mol. Its IUPAC name is (5S)-6-[(2S)-4-amino-1-(6-ethylnaphthalen-2-yl)-4-oxobutan-2-yl]oxy-5-[(1-benzylindole-2-carbonyl)amino]-6-oxohexanoic acid.
| Compound Name | (5S)-6-[(2S)-4-amino-1-(6-ethylnaphthalen-2-yl)-4-oxobutan-2-yl]oxy-5-[(1-benzylindole-2-carbonyl)amino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 57037562 |
| Molecular Formula | C38H39N3O6 |
| Molecular Weight | 633.75 g/mol |
| Exact Mass | 633.28 |
| IUPAC Name | (5S)-6-[(2S)-4-amino-1-(6-ethylnaphthalen-2-yl)-4-oxobutan-2-yl]oxy-5-[(1-benzylindole-2-carbonyl)amino]-6-oxohexanoic acid |
| SMILES | CCc1ccc2cc(C[C@@H](CC(N)=O)OC(=O)[C@H](CCCC(=O)O)NC(=O)c3cc4ccccc4n3Cc3ccccc3)ccc2c1 |
| InChI | InChI=1S/C38H39N3O6/c1-2-25-15-17-29-20-27(16-18-28(29)19-25)21-31(23-35(39)42)47-38(46)32(12-8-14-36(43)44)40-37(45)34-22-30-11-6-7-13-33(30)41(34)24-26-9-4-3-5-10-26/h3-7,9-11,13,15-20,22,31-32H,2,8,12,14,21,23-24H2,1H3,(H2,39,42)(H,40,45)(H,43,44)/t31-,32-/m0/s1 |
| InChIKey | XEYIJQJRGPKKCG-ACHIHNKUSA-N |
| XLogP | 5.79 |
| TPSA | 140.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.75 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |