C20H32O4 — CID 155543504
(1S,4S,6S,8R,10R,13R,14R)-14-(hydroxymethyl)-5,5-dimethyl-9-methylidenetetracyclo[11.2.1.01,10.04,8]hexadecane-4,6,14-triol (PubChem CID 155543504) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (1S,4S,6S,8R,10R,13R,14R)-14-(hydroxymethyl)-5,5-dimethyl-9-methylidenetetracyclo[11.2.1.01,10.04,8]hexadecane-4,6,14-triol.
| Compound Name | (1S,4S,6S,8R,10R,13R,14R)-14-(hydroxymethyl)-5,5-dimethyl-9-methylidenetetracyclo[11.2.1.01,10.04,8]hexadecane-4,6,14-triol |
|---|---|
| PubChem CID | 155543504 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (1S,4S,6S,8R,10R,13R,14R)-14-(hydroxymethyl)-5,5-dimethyl-9-methylidenetetracyclo[11.2.1.01,10.04,8]hexadecane-4,6,14-triol |
| SMILES | C=C1[C@H]2C[C@H](O)C(C)(C)[C@]2(O)CC[C@@]23C[C@@H](CC[C@@H]12)[C@@](O)(CO)C3 |
| InChI | InChI=1S/C20H32O4/c1-12-14-5-4-13-9-18(14,10-19(13,23)11-21)6-7-20(24)15(12)8-16(22)17(20,2)3/h13-16,21-24H,1,4-11H2,2-3H3/t13-,14+,15-,16+,18+,19+,20+/m1/s1 |
| InChIKey | OPXSAGTVGJPWQJ-IZVMADOGSA-N |
| XLogP | 2.00 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|