C26H42O9 — CID 95224289
(2S,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[[(1R,3R,4R,6R,8R,10S,13R,14S)-3,4,14-trihydroxy-5,5,14-trimethyl-9-methylidene-6-tetracyclo[11.2.1.01,10.04,8]hexadecanyl]oxy]oxane-3,4,5-triol (PubChem CID 95224289) has the molecular formula C26H42O9 and a molecular weight of 498.61 g/mol. Its IUPAC name is (2S,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[[(1R,3R,4R,6R,8R,10S,13R,14S)-3,4,14-trihydroxy-5,5,14-trimethyl-9-methylidene-6-tetracyclo[11.2.1.01,10.04,8]hexadecanyl]oxy]oxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[[(1R,3R,4R,6R,8R,10S,13R,14S)-3,4,14-trihydroxy-5,5,14-trimethyl-9-methylidene-6-tetracyclo[11.2.1.01,10.04,8]hexadecanyl]oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 95224289 |
| Molecular Formula | C26H42O9 |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | (2S,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[[(1R,3R,4R,6R,8R,10S,13R,14S)-3,4,14-trihydroxy-5,5,14-trimethyl-9-methylidene-6-tetracyclo[11.2.1.01,10.04,8]hexadecanyl]oxy]oxane-3,4,5-triol |
| SMILES | C=C1[C@H]2CC[C@@H]3C[C@@]2(C[C@@H](O)[C@@]2(O)[C@@H]1C[C@@H](O[C@H]1O[C@@H](CO)[C@@H](O)[C@@H](O)[C@H]1O)C2(C)C)C[C@]3(C)O |
| InChI | InChI=1S/C26H42O9/c1-12-14-6-5-13-8-25(14,11-24(13,4)32)9-17(28)26(33)15(12)7-18(23(26,2)3)35-22-21(31)20(30)19(29)16(10-27)34-22/h13-22,27-33H,1,5-11H2,2-4H3/t13-,14-,15-,16+,17-,18-,19-,20-,21-,22-,24+,25-,26+/m1/s1 |
| InChIKey | ANXMAYKAWZAHMB-GZBJFGIFSA-N |
| XLogP | -0.17 |
| TPSA | 160.07 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|